C15H17F3N4O — CID 125420216
6-pyrrolidin-1-yl-N-[(3S)-1,1,1-trifluorohex-5-yn-3-yl]pyridazine-3-carboxamide (PubChem CID 125420216) has the molecular formula C15H17F3N4O and a molecular weight of 326.32 g/mol. Its IUPAC name is 6-pyrrolidin-1-yl-N-[(3S)-1,1,1-trifluorohex-5-yn-3-yl]pyridazine-3-carboxamide.
| Compound Name | 6-pyrrolidin-1-yl-N-[(3S)-1,1,1-trifluorohex-5-yn-3-yl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 125420216 |
| Molecular Formula | C15H17F3N4O |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 6-pyrrolidin-1-yl-N-[(3S)-1,1,1-trifluorohex-5-yn-3-yl]pyridazine-3-carboxamide |
| SMILES | C#CC[C@@H](CC(F)(F)F)NC(=O)c1ccc(N2CCCC2)nn1 |
| InChI | InChI=1S/C15H17F3N4O/c1-2-5-11(10-15(16,17)18)19-14(23)12-6-7-13(21-20-12)22-8-3-4-9-22/h1,6-7,11H,3-5,8-10H2,(H,19,23)/t11-/m0/s1 |
| InChIKey | LQKCUUQRPQZVFY-NSHDSACASA-N |
| XLogP | 2.15 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|