About N'-(9-ethylpurin-6-yl)-N-(6-methoxypyrimidin-4-yl)propane-1,3-diamine
N'-(9-ethylpurin-6-yl)-N-(6-methoxypyrimidin-4-yl)propane-1,3-diamine (PubChem CID 125420691) has the molecular formula C15H20N8O
and a molecular weight of 328.38 g/mol. Its IUPAC name is N'-(9-ethylpurin-6-yl)-N-(6-methoxypyrimidin-4-yl)propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-(9-ethylpurin-6-yl)-N-(6-methoxypyrimidin-4-yl)propane-1,3-diamine |
| PubChem CID | 125420691 |
| Molecular Formula | C15H20N8O |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | N'-(9-ethylpurin-6-yl)-N-(6-methoxypyrimidin-4-yl)propane-1,3-diamine |
| SMILES | CCn1cnc2c(NCCCNc3cc(OC)ncn3)ncnc21 |
| InChI | InChI=1S/C15H20N8O/c1-3-23-10-22-13-14(20-9-21-15(13)23)17-6-4-5-16-11-7-12(24-2)19-8-18-11/h7-10H,3-6H2,1-2H3,(H,16,18,19)(H,17,20,21) |
| InChIKey | OOFQNHMAJMALSK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(9-ethylpurin-6-yl)-N-(6-methoxypyrimidin-4-yl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(9-ethylpurin-6-yl)-N-(6-methoxypyrimidin-4-yl)propane-1,3-diamine?
The IUPAC name of N'-(9-ethylpurin-6-yl)-N-(6-methoxypyrimidin-4-yl)propane-1,3-diamine (CID 125420691) is N'-(9-ethylpurin-6-yl)-N-(6-methoxypyrimidin-4-yl)propane-1,3-diamine.
What is the SMILES notation for N'-(9-ethylpurin-6-yl)-N-(6-methoxypyrimidin-4-yl)propane-1,3-diamine?
The canonical SMILES for N'-(9-ethylpurin-6-yl)-N-(6-methoxypyrimidin-4-yl)propane-1,3-diamine is CCn1cnc2c(NCCCNc3cc(OC)ncn3)ncnc21.
What is the InChIKey of N'-(9-ethylpurin-6-yl)-N-(6-methoxypyrimidin-4-yl)propane-1,3-diamine?
The InChIKey is OOFQNHMAJMALSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N8O/c1-3-23-10-22-13-14(20-9-21-15(13)23)17-6-4-5-16-11-7-12(24-2)19-8-18-11/h7-10H,3-6H2,1-2H3,(H,16,18,19)(H,17,20,21).
What are the key properties of N'-(9-ethylpurin-6-yl)-N-(6-methoxypyrimidin-4-yl)propane-1,3-diamine?
N'-(9-ethylpurin-6-yl)-N-(6-methoxypyrimidin-4-yl)propane-1,3-diamine has a molecular weight of 328.38 g/mol, XLogP of 1.56, 8 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(9-ethylpurin-6-yl)-N-(6-methoxypyrimidin-4-yl)propane-1,3-diamine is sourced from PubChem (CID 125420691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).