About (2S)-2-[(6-iodothieno[2,3-d]pyrimidin-4-yl)amino]butan-1-ol
(2S)-2-[(6-iodothieno[2,3-d]pyrimidin-4-yl)amino]butan-1-ol (PubChem CID 125421599) has the molecular formula C10H12IN3OS
and a molecular weight of 349.20 g/mol. Its IUPAC name is (2S)-2-[(6-iodothieno[2,3-d]pyrimidin-4-yl)amino]butan-1-ol.
Molecular Properties
| Compound Name | (2S)-2-[(6-iodothieno[2,3-d]pyrimidin-4-yl)amino]butan-1-ol |
| PubChem CID | 125421599 |
| Molecular Formula | C10H12IN3OS |
| Molecular Weight | 349.20 g/mol |
| Exact Mass | 348.97 |
| IUPAC Name | (2S)-2-[(6-iodothieno[2,3-d]pyrimidin-4-yl)amino]butan-1-ol |
| SMILES | CC[C@@H](CO)Nc1ncnc2sc(I)cc12 |
| InChI | InChI=1S/C10H12IN3OS/c1-2-6(4-15)14-9-7-3-8(11)16-10(7)13-5-12-9/h3,5-6,15H,2,4H2,1H3,(H,12,13,14)/t6-/m0/s1 |
| InChIKey | RVXCWRKIFZOOAL-LURJTMIESA-N |
| XLogP | 2.48 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.20 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-[(6-iodothieno[2,3-d]pyrimidin-4-yl)amino]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(6-iodothieno[2,3-d]pyrimidin-4-yl)amino]butan-1-ol?
The IUPAC name of (2S)-2-[(6-iodothieno[2,3-d]pyrimidin-4-yl)amino]butan-1-ol (CID 125421599) is (2S)-2-[(6-iodothieno[2,3-d]pyrimidin-4-yl)amino]butan-1-ol.
What is the SMILES notation for (2S)-2-[(6-iodothieno[2,3-d]pyrimidin-4-yl)amino]butan-1-ol?
The canonical SMILES for (2S)-2-[(6-iodothieno[2,3-d]pyrimidin-4-yl)amino]butan-1-ol is CC[C@@H](CO)Nc1ncnc2sc(I)cc12.
What is the InChIKey of (2S)-2-[(6-iodothieno[2,3-d]pyrimidin-4-yl)amino]butan-1-ol?
The InChIKey is RVXCWRKIFZOOAL-LURJTMIESA-N. The full InChI is InChI=1S/C10H12IN3OS/c1-2-6(4-15)14-9-7-3-8(11)16-10(7)13-5-12-9/h3,5-6,15H,2,4H2,1H3,(H,12,13,14)/t6-/m0/s1.
What are the key properties of (2S)-2-[(6-iodothieno[2,3-d]pyrimidin-4-yl)amino]butan-1-ol?
(2S)-2-[(6-iodothieno[2,3-d]pyrimidin-4-yl)amino]butan-1-ol has a molecular weight of 349.20 g/mol, XLogP of 2.48, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(6-iodothieno[2,3-d]pyrimidin-4-yl)amino]butan-1-ol is sourced from PubChem (CID 125421599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).