C19H21F2N3O — CID 125421692
1-(2,4-difluorophenyl)-N-[(7S)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-yl]cyclopentane-1-carboxamide (PubChem CID 125421692) has the molecular formula C19H21F2N3O and a molecular weight of 345.39 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-N-[(7S)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-yl]cyclopentane-1-carboxamide.
| Compound Name | 1-(2,4-difluorophenyl)-N-[(7S)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-yl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 125421692 |
| Molecular Formula | C19H21F2N3O |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 1-(2,4-difluorophenyl)-N-[(7S)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-7-yl]cyclopentane-1-carboxamide |
| SMILES | O=C(N[C@H]1CCn2cncc2C1)C1(c2ccc(F)cc2F)CCCC1 |
| InChI | InChI=1S/C19H21F2N3O/c20-13-3-4-16(17(21)9-13)19(6-1-2-7-19)18(25)23-14-5-8-24-12-22-11-15(24)10-14/h3-4,9,11-12,14H,1-2,5-8,10H2,(H,23,25)/t14-/m0/s1 |
| InChIKey | HWMPMBWNSMEJQG-AWEZNQCLSA-N |
| XLogP | 3.10 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |