C11H19N3O — CID 125422242
2-[[(1R)-cyclohex-3-en-1-yl]methylamino]-1,4,5,6-tetrahydropyrimidin-5-ol (PubChem CID 125422242) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-[[(1R)-cyclohex-3-en-1-yl]methylamino]-1,4,5,6-tetrahydropyrimidin-5-ol.
| Compound Name | 2-[[(1R)-cyclohex-3-en-1-yl]methylamino]-1,4,5,6-tetrahydropyrimidin-5-ol |
|---|---|
| PubChem CID | 125422242 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 2-[[(1R)-cyclohex-3-en-1-yl]methylamino]-1,4,5,6-tetrahydropyrimidin-5-ol |
| SMILES | OC1CN=C(NC[C@H]2CC=CCC2)NC1 |
| InChI | InChI=1S/C11H19N3O/c15-10-7-13-11(14-8-10)12-6-9-4-2-1-3-5-9/h1-2,9-10,15H,3-8H2,(H2,12,13,14)/t9-/m0/s1 |
| InChIKey | DNNCICJMWPUCRJ-VIFPVBQESA-N |
| XLogP | 0.25 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|