C8H15N3O — CID 125422264
2-(2-methylprop-2-enylamino)-1,4,5,6-tetrahydropyrimidin-5-ol (PubChem CID 125422264) has the molecular formula C8H15N3O and a molecular weight of 169.23 g/mol. Its IUPAC name is 2-(2-methylprop-2-enylamino)-1,4,5,6-tetrahydropyrimidin-5-ol.
| Compound Name | 2-(2-methylprop-2-enylamino)-1,4,5,6-tetrahydropyrimidin-5-ol |
|---|---|
| PubChem CID | 125422264 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | 2-(2-methylprop-2-enylamino)-1,4,5,6-tetrahydropyrimidin-5-ol |
| SMILES | C=C(C)CNC1=NCC(O)CN1 |
| InChI | InChI=1S/C8H15N3O/c1-6(2)3-9-8-10-4-7(12)5-11-8/h7,12H,1,3-5H2,2H3,(H2,9,10,11) |
| InChIKey | RREUXXBEHYDDOV-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|