About 1,1-bis(ethylsulfanyl)-N,N-dimethylmethanamine
1,1-bis(ethylsulfanyl)-N,N-dimethylmethanamine (PubChem CID 12542360) has the molecular formula C7H17NS2
and a molecular weight of 179.35 g/mol. Its IUPAC name is 1,1-bis(ethylsulfanyl)-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1,1-bis(ethylsulfanyl)-N,N-dimethylmethanamine |
| PubChem CID | 12542360 |
| Molecular Formula | C7H17NS2 |
| Molecular Weight | 179.35 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 1,1-bis(ethylsulfanyl)-N,N-dimethylmethanamine |
| SMILES | CCSC(SCC)N(C)C |
| InChI | InChI=1S/C7H17NS2/c1-5-9-7(8(3)4)10-6-2/h7H,5-6H2,1-4H3 |
| InChIKey | XRQLKMQFSLCAFN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-bis(ethylsulfanyl)-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-bis(ethylsulfanyl)-N,N-dimethylmethanamine?
The IUPAC name of 1,1-bis(ethylsulfanyl)-N,N-dimethylmethanamine (CID 12542360) is 1,1-bis(ethylsulfanyl)-N,N-dimethylmethanamine.
What is the SMILES notation for 1,1-bis(ethylsulfanyl)-N,N-dimethylmethanamine?
The canonical SMILES for 1,1-bis(ethylsulfanyl)-N,N-dimethylmethanamine is CCSC(SCC)N(C)C.
What is the InChIKey of 1,1-bis(ethylsulfanyl)-N,N-dimethylmethanamine?
The InChIKey is XRQLKMQFSLCAFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17NS2/c1-5-9-7(8(3)4)10-6-2/h7H,5-6H2,1-4H3.
What are the key properties of 1,1-bis(ethylsulfanyl)-N,N-dimethylmethanamine?
1,1-bis(ethylsulfanyl)-N,N-dimethylmethanamine has a molecular weight of 179.35 g/mol, XLogP of 2.34, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-bis(ethylsulfanyl)-N,N-dimethylmethanamine is sourced from PubChem (CID 12542360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).