About 3-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-4-fluorobenzonitrile
3-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-4-fluorobenzonitrile (PubChem CID 125423721) has the molecular formula C18H17FN2O2S
and a molecular weight of 344.41 g/mol. Its IUPAC name is 3-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-4-fluorobenzonitrile.
Molecular Properties
| Compound Name | 3-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-4-fluorobenzonitrile |
| PubChem CID | 125423721 |
| Molecular Formula | C18H17FN2O2S |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 3-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-4-fluorobenzonitrile |
| SMILES | N#Cc1ccc(F)c(-c2ccc(CN3CCS(=O)(=O)CC3)cc2)c1 |
| InChI | InChI=1S/C18H17FN2O2S/c19-18-6-3-15(12-20)11-17(18)16-4-1-14(2-5-16)13-21-7-9-24(22,23)10-8-21/h1-6,11H,7-10,13H2 |
| InChIKey | NYAKCVZREDZBTC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-4-fluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-4-fluorobenzonitrile?
The IUPAC name of 3-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-4-fluorobenzonitrile (CID 125423721) is 3-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-4-fluorobenzonitrile.
What is the SMILES notation for 3-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-4-fluorobenzonitrile?
The canonical SMILES for 3-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-4-fluorobenzonitrile is N#Cc1ccc(F)c(-c2ccc(CN3CCS(=O)(=O)CC3)cc2)c1.
What is the InChIKey of 3-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-4-fluorobenzonitrile?
The InChIKey is NYAKCVZREDZBTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17FN2O2S/c19-18-6-3-15(12-20)11-17(18)16-4-1-14(2-5-16)13-21-7-9-24(22,23)10-8-21/h1-6,11H,7-10,13H2.
What are the key properties of 3-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-4-fluorobenzonitrile?
3-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-4-fluorobenzonitrile has a molecular weight of 344.41 g/mol, XLogP of 2.59, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]phenyl]-4-fluorobenzonitrile is sourced from PubChem (CID 125423721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).