C10H16N6S — CID 125423835
3-ethyl-N-[3-(2-methyl-1,2,4-triazol-3-yl)propyl]-1,2,4-thiadiazol-5-amine (PubChem CID 125423835) has the molecular formula C10H16N6S and a molecular weight of 252.35 g/mol. Its IUPAC name is 3-ethyl-N-[3-(2-methyl-1,2,4-triazol-3-yl)propyl]-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-ethyl-N-[3-(2-methyl-1,2,4-triazol-3-yl)propyl]-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 125423835 |
| Molecular Formula | C10H16N6S |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 3-ethyl-N-[3-(2-methyl-1,2,4-triazol-3-yl)propyl]-1,2,4-thiadiazol-5-amine |
| SMILES | CCc1nsc(NCCCc2ncnn2C)n1 |
| InChI | InChI=1S/C10H16N6S/c1-3-8-14-10(17-15-8)11-6-4-5-9-12-7-13-16(9)2/h7H,3-6H2,1-2H3,(H,11,14,15) |
| InChIKey | HIBNCEHZGGHITM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|