C11H22N4S — CID 125423962
N-(3-ethyl-1,2,4-thiadiazol-5-yl)-N'-pentan-3-ylethane-1,2-diamine (PubChem CID 125423962) has the molecular formula C11H22N4S and a molecular weight of 242.39 g/mol. Its IUPAC name is N-(3-ethyl-1,2,4-thiadiazol-5-yl)-N'-pentan-3-ylethane-1,2-diamine.
| Compound Name | N-(3-ethyl-1,2,4-thiadiazol-5-yl)-N'-pentan-3-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 125423962 |
| Molecular Formula | C11H22N4S |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | N-(3-ethyl-1,2,4-thiadiazol-5-yl)-N'-pentan-3-ylethane-1,2-diamine |
| SMILES | CCc1nsc(NCCNC(CC)CC)n1 |
| InChI | InChI=1S/C11H22N4S/c1-4-9(5-2)12-7-8-13-11-14-10(6-3)15-16-11/h9,12H,4-8H2,1-3H3,(H,13,14,15) |
| InChIKey | QLGPUQCNEKVCEU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|