C13H14N6S2 — CID 125424008
N'-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)-N-thieno[2,3-d]pyrimidin-4-ylethane-1,2-diamine (PubChem CID 125424008) has the molecular formula C13H14N6S2 and a molecular weight of 318.43 g/mol. Its IUPAC name is N'-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)-N-thieno[2,3-d]pyrimidin-4-ylethane-1,2-diamine.
| Compound Name | N'-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)-N-thieno[2,3-d]pyrimidin-4-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 125424008 |
| Molecular Formula | C13H14N6S2 |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | N'-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)-N-thieno[2,3-d]pyrimidin-4-ylethane-1,2-diamine |
| SMILES | c1nc(NCCNc2nc(C3CC3)ns2)c2ccsc2n1 |
| InChI | InChI=1S/C13H14N6S2/c1-2-8(1)10-18-13(21-19-10)15-5-4-14-11-9-3-6-20-12(9)17-7-16-11/h3,6-8H,1-2,4-5H2,(H,14,16,17)(H,15,18,19) |
| InChIKey | UZFFLISPTGBHMK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|