C5H7Br2N — CID 125424367
(1S,5S)-6,6-dibromo-3-azabicyclo[3.1.0]hexane (PubChem CID 125424367) has the molecular formula C5H7Br2N and a molecular weight of 240.93 g/mol. Its IUPAC name is (1S,5S)-6,6-dibromo-3-azabicyclo[3.1.0]hexane.
| Compound Name | (1S,5S)-6,6-dibromo-3-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 125424367 |
| Molecular Formula | C5H7Br2N |
| Molecular Weight | 240.93 g/mol |
| Exact Mass | 238.89 |
| IUPAC Name | (1S,5S)-6,6-dibromo-3-azabicyclo[3.1.0]hexane |
| SMILES | BrC1(Br)[C@@H]2CNC[C@H]21 |
| InChI | InChI=1S/C5H7Br2N/c6-5(7)3-1-8-2-4(3)5/h3-4,8H,1-2H2/t3-,4-/m1/s1 |
| InChIKey | ABURLYYXXXDZKZ-QWWZWVQMSA-N |
| XLogP | 1.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.93 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|