About (1S,5S)-6,6-dibromo-3-azabicyclo[3.1.0]hexane
(1S,5S)-6,6-dibromo-3-azabicyclo[3.1.0]hexane (PubChem CID 125424367) has the molecular formula C5H7Br2N
and a molecular weight of 240.93 g/mol. Its IUPAC name is (1S,5S)-6,6-dibromo-3-azabicyclo[3.1.0]hexane.
Molecular Properties
| Compound Name | (1S,5S)-6,6-dibromo-3-azabicyclo[3.1.0]hexane |
| PubChem CID | 125424367 |
| Molecular Formula | C5H7Br2N |
| Molecular Weight | 240.93 g/mol |
| Exact Mass | 238.89 |
| IUPAC Name | (1S,5S)-6,6-dibromo-3-azabicyclo[3.1.0]hexane |
| SMILES | BrC1(Br)[C@@H]2CNC[C@H]21 |
| InChI | InChI=1S/C5H7Br2N/c6-5(7)3-1-8-2-4(3)5/h3-4,8H,1-2H2/t3-,4-/m1/s1 |
| InChIKey | ABURLYYXXXDZKZ-QWWZWVQMSA-N |
| XLogP | 1.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.93 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (1S,5S)-6,6-dibromo-3-azabicyclo[3.1.0]hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5S)-6,6-dibromo-3-azabicyclo[3.1.0]hexane?
The IUPAC name of (1S,5S)-6,6-dibromo-3-azabicyclo[3.1.0]hexane (CID 125424367) is (1S,5S)-6,6-dibromo-3-azabicyclo[3.1.0]hexane.
What is the SMILES notation for (1S,5S)-6,6-dibromo-3-azabicyclo[3.1.0]hexane?
The canonical SMILES for (1S,5S)-6,6-dibromo-3-azabicyclo[3.1.0]hexane is BrC1(Br)[C@@H]2CNC[C@H]21.
What is the InChIKey of (1S,5S)-6,6-dibromo-3-azabicyclo[3.1.0]hexane?
The InChIKey is ABURLYYXXXDZKZ-QWWZWVQMSA-N. The full InChI is InChI=1S/C5H7Br2N/c6-5(7)3-1-8-2-4(3)5/h3-4,8H,1-2H2/t3-,4-/m1/s1.
What are the key properties of (1S,5S)-6,6-dibromo-3-azabicyclo[3.1.0]hexane?
(1S,5S)-6,6-dibromo-3-azabicyclo[3.1.0]hexane has a molecular weight of 240.93 g/mol, XLogP of 1.32, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5S)-6,6-dibromo-3-azabicyclo[3.1.0]hexane is sourced from PubChem (CID 125424367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).