About 2-amino-6,7-difluoro-4-oxo-1H-quinoline-3-carbonitrile
2-amino-6,7-difluoro-4-oxo-1H-quinoline-3-carbonitrile (PubChem CID 125424459) has the molecular formula C10H5F2N3O
and a molecular weight of 221.17 g/mol. Its IUPAC name is 2-amino-6,7-difluoro-4-oxo-1H-quinoline-3-carbonitrile.
Molecular Properties
| Compound Name | 2-amino-6,7-difluoro-4-oxo-1H-quinoline-3-carbonitrile |
| PubChem CID | 125424459 |
| Molecular Formula | C10H5F2N3O |
| Molecular Weight | 221.17 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 2-amino-6,7-difluoro-4-oxo-1H-quinoline-3-carbonitrile |
| SMILES | N#Cc1c(N)[nH]c2cc(F)c(F)cc2c1=O |
| InChI | InChI=1S/C10H5F2N3O/c11-6-1-4-8(2-7(6)12)15-10(14)5(3-13)9(4)16/h1-2H,(H3,14,15,16) |
| InChIKey | HCBZVDMQWJRHEK-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 82.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.17 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-6,7-difluoro-4-oxo-1H-quinoline-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-6,7-difluoro-4-oxo-1H-quinoline-3-carbonitrile?
The IUPAC name of 2-amino-6,7-difluoro-4-oxo-1H-quinoline-3-carbonitrile (CID 125424459) is 2-amino-6,7-difluoro-4-oxo-1H-quinoline-3-carbonitrile.
What is the SMILES notation for 2-amino-6,7-difluoro-4-oxo-1H-quinoline-3-carbonitrile?
The canonical SMILES for 2-amino-6,7-difluoro-4-oxo-1H-quinoline-3-carbonitrile is N#Cc1c(N)[nH]c2cc(F)c(F)cc2c1=O.
What is the InChIKey of 2-amino-6,7-difluoro-4-oxo-1H-quinoline-3-carbonitrile?
The InChIKey is HCBZVDMQWJRHEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5F2N3O/c11-6-1-4-8(2-7(6)12)15-10(14)5(3-13)9(4)16/h1-2H,(H3,14,15,16).
What are the key properties of 2-amino-6,7-difluoro-4-oxo-1H-quinoline-3-carbonitrile?
2-amino-6,7-difluoro-4-oxo-1H-quinoline-3-carbonitrile has a molecular weight of 221.17 g/mol, XLogP of 1.26, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-6,7-difluoro-4-oxo-1H-quinoline-3-carbonitrile is sourced from PubChem (CID 125424459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).