C10H7F7O — CID 125424508
[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]methanol (PubChem CID 125424508) has the molecular formula C10H7F7O and a molecular weight of 276.15 g/mol. Its IUPAC name is [4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]methanol.
| Compound Name | [4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]methanol |
|---|---|
| PubChem CID | 125424508 |
| Molecular Formula | C10H7F7O |
| Molecular Weight | 276.15 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | [4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]methanol |
| SMILES | OCc1ccc(C(F)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C10H7F7O/c11-8(9(12,13)14,10(15,16)17)7-3-1-6(5-18)2-4-7/h1-4,18H,5H2 |
| InChIKey | GKVZAWSAJJIQMI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.15 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |