(2R)-2,3-dimethoxypropane-1-sulfonyl chloride

C5H11ClO4S — CID 125424529

IUPAC(2R)-2,3-dimethoxypropane-1-sulfonyl chloride
SMILESCOC[C@H](CS(=O)(=O)Cl)OC
InChIInChI=1S/C5H11ClO4S/c1-9-3-5(10-2)4-11(6,7)8/h5H,3-4H2,1-2H3/t5-/m1/s1
InChIKeyNZRWKUFLBBONMX-RXMQYKEDSA-N
MW202.66 g/mol
LogP0.22
Rot. Bonds5

About (2R)-2,3-dimethoxypropane-1-sulfonyl chloride

(2R)-2,3-dimethoxypropane-1-sulfonyl chloride (PubChem CID 125424529) has the molecular formula C5H11ClO4S and a molecular weight of 202.66 g/mol. Its IUPAC name is (2R)-2,3-dimethoxypropane-1-sulfonyl chloride.

Molecular Properties

Compound Name(2R)-2,3-dimethoxypropane-1-sulfonyl chloride
PubChem CID125424529
Molecular FormulaC5H11ClO4S
Molecular Weight202.66 g/mol
Exact Mass202.01
IUPAC Name(2R)-2,3-dimethoxypropane-1-sulfonyl chloride
SMILESCOC[C@H](CS(=O)(=O)Cl)OC
InChIInChI=1S/C5H11ClO4S/c1-9-3-5(10-2)4-11(6,7)8/h5H,3-4H2,1-2H3/t5-/m1/s1
InChIKeyNZRWKUFLBBONMX-RXMQYKEDSA-N
XLogP0.22
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.66
LogP ≤ 50.22
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze (2R)-2,3-dimethoxypropane-1-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2,3-dimethoxypropane-1-sulfonyl chloride?
The IUPAC name of (2R)-2,3-dimethoxypropane-1-sulfonyl chloride (CID 125424529) is (2R)-2,3-dimethoxypropane-1-sulfonyl chloride.
What is the SMILES notation for (2R)-2,3-dimethoxypropane-1-sulfonyl chloride?
The canonical SMILES for (2R)-2,3-dimethoxypropane-1-sulfonyl chloride is COC[C@H](CS(=O)(=O)Cl)OC.
What is the InChIKey of (2R)-2,3-dimethoxypropane-1-sulfonyl chloride?
The InChIKey is NZRWKUFLBBONMX-RXMQYKEDSA-N. The full InChI is InChI=1S/C5H11ClO4S/c1-9-3-5(10-2)4-11(6,7)8/h5H,3-4H2,1-2H3/t5-/m1/s1.
What are the key properties of (2R)-2,3-dimethoxypropane-1-sulfonyl chloride?
(2R)-2,3-dimethoxypropane-1-sulfonyl chloride has a molecular weight of 202.66 g/mol, XLogP of 0.22, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2,3-dimethoxypropane-1-sulfonyl chloride is sourced from PubChem (CID 125424529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).