About (2S)-2,3-dimethoxypropane-1-sulfonyl chloride
(2S)-2,3-dimethoxypropane-1-sulfonyl chloride (PubChem CID 125424530) has the molecular formula C5H11ClO4S
and a molecular weight of 202.66 g/mol. Its IUPAC name is (2S)-2,3-dimethoxypropane-1-sulfonyl chloride.
Molecular Properties
| Compound Name | (2S)-2,3-dimethoxypropane-1-sulfonyl chloride |
| PubChem CID | 125424530 |
| Molecular Formula | C5H11ClO4S |
| Molecular Weight | 202.66 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | (2S)-2,3-dimethoxypropane-1-sulfonyl chloride |
| SMILES | COC[C@@H](CS(=O)(=O)Cl)OC |
| InChI | InChI=1S/C5H11ClO4S/c1-9-3-5(10-2)4-11(6,7)8/h5H,3-4H2,1-2H3/t5-/m0/s1 |
| InChIKey | NZRWKUFLBBONMX-YFKPBYRVSA-N |
| XLogP | 0.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.66 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-2,3-dimethoxypropane-1-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2,3-dimethoxypropane-1-sulfonyl chloride?
The IUPAC name of (2S)-2,3-dimethoxypropane-1-sulfonyl chloride (CID 125424530) is (2S)-2,3-dimethoxypropane-1-sulfonyl chloride.
What is the SMILES notation for (2S)-2,3-dimethoxypropane-1-sulfonyl chloride?
The canonical SMILES for (2S)-2,3-dimethoxypropane-1-sulfonyl chloride is COC[C@@H](CS(=O)(=O)Cl)OC.
What is the InChIKey of (2S)-2,3-dimethoxypropane-1-sulfonyl chloride?
The InChIKey is NZRWKUFLBBONMX-YFKPBYRVSA-N. The full InChI is InChI=1S/C5H11ClO4S/c1-9-3-5(10-2)4-11(6,7)8/h5H,3-4H2,1-2H3/t5-/m0/s1.
What are the key properties of (2S)-2,3-dimethoxypropane-1-sulfonyl chloride?
(2S)-2,3-dimethoxypropane-1-sulfonyl chloride has a molecular weight of 202.66 g/mol, XLogP of 0.22, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,3-dimethoxypropane-1-sulfonyl chloride is sourced from PubChem (CID 125424530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).