About [(3S,5S)-3-ethyl-5-(iodomethyl)oxolan-3-yl]methanol
[(3S,5S)-3-ethyl-5-(iodomethyl)oxolan-3-yl]methanol (PubChem CID 125424786) has the molecular formula C8H15IO2
and a molecular weight of 270.11 g/mol. Its IUPAC name is [(3S,5S)-3-ethyl-5-(iodomethyl)oxolan-3-yl]methanol.
Molecular Properties
| Compound Name | [(3S,5S)-3-ethyl-5-(iodomethyl)oxolan-3-yl]methanol |
| PubChem CID | 125424786 |
| Molecular Formula | C8H15IO2 |
| Molecular Weight | 270.11 g/mol |
| Exact Mass | 270.01 |
| IUPAC Name | [(3S,5S)-3-ethyl-5-(iodomethyl)oxolan-3-yl]methanol |
| SMILES | CC[C@]1(CO)CO[C@H](CI)C1 |
| InChI | InChI=1S/C8H15IO2/c1-2-8(5-10)3-7(4-9)11-6-8/h7,10H,2-6H2,1H3/t7-,8-/m0/s1 |
| InChIKey | ZICPUOILXZMYGJ-YUMQZZPRSA-N |
| XLogP | 1.60 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.11 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [(3S,5S)-3-ethyl-5-(iodomethyl)oxolan-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,5S)-3-ethyl-5-(iodomethyl)oxolan-3-yl]methanol?
The IUPAC name of [(3S,5S)-3-ethyl-5-(iodomethyl)oxolan-3-yl]methanol (CID 125424786) is [(3S,5S)-3-ethyl-5-(iodomethyl)oxolan-3-yl]methanol.
What is the SMILES notation for [(3S,5S)-3-ethyl-5-(iodomethyl)oxolan-3-yl]methanol?
The canonical SMILES for [(3S,5S)-3-ethyl-5-(iodomethyl)oxolan-3-yl]methanol is CC[C@]1(CO)CO[C@H](CI)C1.
What is the InChIKey of [(3S,5S)-3-ethyl-5-(iodomethyl)oxolan-3-yl]methanol?
The InChIKey is ZICPUOILXZMYGJ-YUMQZZPRSA-N. The full InChI is InChI=1S/C8H15IO2/c1-2-8(5-10)3-7(4-9)11-6-8/h7,10H,2-6H2,1H3/t7-,8-/m0/s1.
What are the key properties of [(3S,5S)-3-ethyl-5-(iodomethyl)oxolan-3-yl]methanol?
[(3S,5S)-3-ethyl-5-(iodomethyl)oxolan-3-yl]methanol has a molecular weight of 270.11 g/mol, XLogP of 1.60, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,5S)-3-ethyl-5-(iodomethyl)oxolan-3-yl]methanol is sourced from PubChem (CID 125424786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).