About N-[ethyl-(1-ethylbenzimidazol-2-yl)-oxo-λ6-sulfanylidene]sulfamoyl chloride
N-[ethyl-(1-ethylbenzimidazol-2-yl)-oxo-λ6-sulfanylidene]sulfamoyl chloride (PubChem CID 125424906) has the molecular formula C11H14ClN3O3S2
and a molecular weight of 335.84 g/mol. Its IUPAC name is N-[ethyl-(1-ethylbenzimidazol-2-yl)-oxo-λ6-sulfanylidene]sulfamoyl chloride.
Molecular Properties
| Compound Name | N-[ethyl-(1-ethylbenzimidazol-2-yl)-oxo-λ6-sulfanylidene]sulfamoyl chloride |
| PubChem CID | 125424906 |
| Molecular Formula | C11H14ClN3O3S2 |
| Molecular Weight | 335.84 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | N-[ethyl-(1-ethylbenzimidazol-2-yl)-oxo-λ6-sulfanylidene]sulfamoyl chloride |
| SMILES | CCn1c([S@@](=O)(CC)=NS(=O)(=O)Cl)nc2ccccc21 |
| InChI | InChI=1S/C11H14ClN3O3S2/c1-3-15-10-8-6-5-7-9(10)13-11(15)19(16,4-2)14-20(12,17)18/h5-8H,3-4H2,1-2H3/t19-/m0/s1 |
| InChIKey | CTWYYEAVLPVGQU-IBGZPJMESA-N |
| XLogP | 2.39 |
| TPSA | 81.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.84 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[ethyl-(1-ethylbenzimidazol-2-yl)-oxo-λ6-sulfanylidene]sulfamoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[ethyl-(1-ethylbenzimidazol-2-yl)-oxo-λ6-sulfanylidene]sulfamoyl chloride?
The IUPAC name of N-[ethyl-(1-ethylbenzimidazol-2-yl)-oxo-λ6-sulfanylidene]sulfamoyl chloride (CID 125424906) is N-[ethyl-(1-ethylbenzimidazol-2-yl)-oxo-λ6-sulfanylidene]sulfamoyl chloride.
What is the SMILES notation for N-[ethyl-(1-ethylbenzimidazol-2-yl)-oxo-λ6-sulfanylidene]sulfamoyl chloride?
The canonical SMILES for N-[ethyl-(1-ethylbenzimidazol-2-yl)-oxo-λ6-sulfanylidene]sulfamoyl chloride is CCn1c([S@@](=O)(CC)=NS(=O)(=O)Cl)nc2ccccc21.
What is the InChIKey of N-[ethyl-(1-ethylbenzimidazol-2-yl)-oxo-λ6-sulfanylidene]sulfamoyl chloride?
The InChIKey is CTWYYEAVLPVGQU-IBGZPJMESA-N. The full InChI is InChI=1S/C11H14ClN3O3S2/c1-3-15-10-8-6-5-7-9(10)13-11(15)19(16,4-2)14-20(12,17)18/h5-8H,3-4H2,1-2H3/t19-/m0/s1.
What are the key properties of N-[ethyl-(1-ethylbenzimidazol-2-yl)-oxo-λ6-sulfanylidene]sulfamoyl chloride?
N-[ethyl-(1-ethylbenzimidazol-2-yl)-oxo-λ6-sulfanylidene]sulfamoyl chloride has a molecular weight of 335.84 g/mol, XLogP of 2.39, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[ethyl-(1-ethylbenzimidazol-2-yl)-oxo-λ6-sulfanylidene]sulfamoyl chloride is sourced from PubChem (CID 125424906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).