About trans-(1S,2R)-2-(2-methylsulfonylpropan-2-yl)cyclopropane-1-carbaldehyde
trans-(1S,2R)-2-(2-methylsulfonylpropan-2-yl)cyclopropane-1-carbaldehyde (PubChem CID 125425514) has the molecular formula C8H14O3S
and a molecular weight of 190.26 g/mol. Its IUPAC name is trans-(1S,2R)-2-(2-methylsulfonylpropan-2-yl)cyclopropane-1-carbaldehyde.
Molecular Properties
| Compound Name | trans-(1S,2R)-2-(2-methylsulfonylpropan-2-yl)cyclopropane-1-carbaldehyde |
| PubChem CID | 125425514 |
| Molecular Formula | C8H14O3S |
| Molecular Weight | 190.26 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | trans-(1S,2R)-2-(2-methylsulfonylpropan-2-yl)cyclopropane-1-carbaldehyde |
| SMILES | CC(C)([C@@H]1C[C@@H]1C=O)S(C)(=O)=O |
| InChI | InChI=1S/C8H14O3S/c1-8(2,12(3,10)11)7-4-6(7)5-9/h5-7H,4H2,1-3H3/t6-,7-/m1/s1 |
| InChIKey | IZXCZGYVCSEPIY-RNFRBKRXSA-N |
| XLogP | 0.64 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.26 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze trans-(1S,2R)-2-(2-methylsulfonylpropan-2-yl)cyclopropane-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2R)-2-(2-methylsulfonylpropan-2-yl)cyclopropane-1-carbaldehyde?
The IUPAC name of trans-(1S,2R)-2-(2-methylsulfonylpropan-2-yl)cyclopropane-1-carbaldehyde (CID 125425514) is trans-(1S,2R)-2-(2-methylsulfonylpropan-2-yl)cyclopropane-1-carbaldehyde.
What is the SMILES notation for trans-(1S,2R)-2-(2-methylsulfonylpropan-2-yl)cyclopropane-1-carbaldehyde?
The canonical SMILES for trans-(1S,2R)-2-(2-methylsulfonylpropan-2-yl)cyclopropane-1-carbaldehyde is CC(C)([C@@H]1C[C@@H]1C=O)S(C)(=O)=O.
What is the InChIKey of trans-(1S,2R)-2-(2-methylsulfonylpropan-2-yl)cyclopropane-1-carbaldehyde?
The InChIKey is IZXCZGYVCSEPIY-RNFRBKRXSA-N. The full InChI is InChI=1S/C8H14O3S/c1-8(2,12(3,10)11)7-4-6(7)5-9/h5-7H,4H2,1-3H3/t6-,7-/m1/s1.
What are the key properties of trans-(1S,2R)-2-(2-methylsulfonylpropan-2-yl)cyclopropane-1-carbaldehyde?
trans-(1S,2R)-2-(2-methylsulfonylpropan-2-yl)cyclopropane-1-carbaldehyde has a molecular weight of 190.26 g/mol, XLogP of 0.64, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2R)-2-(2-methylsulfonylpropan-2-yl)cyclopropane-1-carbaldehyde is sourced from PubChem (CID 125425514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).