About 3-(4-methoxyphenyl)-1,2-oxazole-5-sulfonyl chloride
3-(4-methoxyphenyl)-1,2-oxazole-5-sulfonyl chloride (PubChem CID 125425595) has the molecular formula C10H8ClNO4S
and a molecular weight of 273.70 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-1,2-oxazole-5-sulfonyl chloride.
Molecular Properties
| Compound Name | 3-(4-methoxyphenyl)-1,2-oxazole-5-sulfonyl chloride |
| PubChem CID | 125425595 |
| Molecular Formula | C10H8ClNO4S |
| Molecular Weight | 273.70 g/mol |
| Exact Mass | 272.99 |
| IUPAC Name | 3-(4-methoxyphenyl)-1,2-oxazole-5-sulfonyl chloride |
| SMILES | COc1ccc(-c2cc(S(=O)(=O)Cl)on2)cc1 |
| InChI | InChI=1S/C10H8ClNO4S/c1-15-8-4-2-7(3-5-8)9-6-10(16-12-9)17(11,13)14/h2-6H,1H3 |
| InChIKey | LJAFUEOPUDMYED-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.70 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(4-methoxyphenyl)-1,2-oxazole-5-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-methoxyphenyl)-1,2-oxazole-5-sulfonyl chloride?
The IUPAC name of 3-(4-methoxyphenyl)-1,2-oxazole-5-sulfonyl chloride (CID 125425595) is 3-(4-methoxyphenyl)-1,2-oxazole-5-sulfonyl chloride.
What is the SMILES notation for 3-(4-methoxyphenyl)-1,2-oxazole-5-sulfonyl chloride?
The canonical SMILES for 3-(4-methoxyphenyl)-1,2-oxazole-5-sulfonyl chloride is COc1ccc(-c2cc(S(=O)(=O)Cl)on2)cc1.
What is the InChIKey of 3-(4-methoxyphenyl)-1,2-oxazole-5-sulfonyl chloride?
The InChIKey is LJAFUEOPUDMYED-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClNO4S/c1-15-8-4-2-7(3-5-8)9-6-10(16-12-9)17(11,13)14/h2-6H,1H3.
What are the key properties of 3-(4-methoxyphenyl)-1,2-oxazole-5-sulfonyl chloride?
3-(4-methoxyphenyl)-1,2-oxazole-5-sulfonyl chloride has a molecular weight of 273.70 g/mol, XLogP of 2.28, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methoxyphenyl)-1,2-oxazole-5-sulfonyl chloride is sourced from PubChem (CID 125425595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).