C13H15NO — CID 125425746
2-[(1R,3S)-1-hydroxy-3-methylcyclopentyl]benzonitrile (PubChem CID 125425746) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-[(1R,3S)-1-hydroxy-3-methylcyclopentyl]benzonitrile.
| Compound Name | 2-[(1R,3S)-1-hydroxy-3-methylcyclopentyl]benzonitrile |
|---|---|
| PubChem CID | 125425746 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 2-[(1R,3S)-1-hydroxy-3-methylcyclopentyl]benzonitrile |
| SMILES | C[C@H]1CC[C@](O)(c2ccccc2C#N)C1 |
| InChI | InChI=1S/C13H15NO/c1-10-6-7-13(15,8-10)12-5-3-2-4-11(12)9-14/h2-5,10,15H,6-8H2,1H3/t10-,13+/m0/s1 |
| InChIKey | AZUXUMOKRPLQNO-GXFFZTMASA-N |
| XLogP | 2.57 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |