3-(4-propan-2-ylcyclohexyl)-1,2-oxazole-4-carboxylic acid

C13H19NO3 — CID 125426240

IUPAC3-(4-propan-2-ylcyclohexyl)-1,2-oxazole-4-carboxylic acid
SMILESCC(C)C1CCC(c2nocc2C(=O)O)CC1
InChIInChI=1S/C13H19NO3/c1-8(2)9-3-5-10(6-4-9)12-11(13(15)16)7-17-14-12/h7-10H,3-6H2,1-2H3,(H,15,16)
InChIKeyXYGAHGKITXGMEY-UHFFFAOYSA-N
MW237.30 g/mol
LogP3.30
Rot. Bonds3

About 3-(4-propan-2-ylcyclohexyl)-1,2-oxazole-4-carboxylic acid

3-(4-propan-2-ylcyclohexyl)-1,2-oxazole-4-carboxylic acid (PubChem CID 125426240) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 3-(4-propan-2-ylcyclohexyl)-1,2-oxazole-4-carboxylic acid.

Molecular Properties

Compound Name3-(4-propan-2-ylcyclohexyl)-1,2-oxazole-4-carboxylic acid
PubChem CID125426240
Molecular FormulaC13H19NO3
Molecular Weight237.30 g/mol
Exact Mass237.14
IUPAC Name3-(4-propan-2-ylcyclohexyl)-1,2-oxazole-4-carboxylic acid
SMILESCC(C)C1CCC(c2nocc2C(=O)O)CC1
InChIInChI=1S/C13H19NO3/c1-8(2)9-3-5-10(6-4-9)12-11(13(15)16)7-17-14-12/h7-10H,3-6H2,1-2H3,(H,15,16)
InChIKeyXYGAHGKITXGMEY-UHFFFAOYSA-N
XLogP3.30
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.30
LogP ≤ 53.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(4-propan-2-ylcyclohexyl)-1,2-oxazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-propan-2-ylcyclohexyl)-1,2-oxazole-4-carboxylic acid?
The IUPAC name of 3-(4-propan-2-ylcyclohexyl)-1,2-oxazole-4-carboxylic acid (CID 125426240) is 3-(4-propan-2-ylcyclohexyl)-1,2-oxazole-4-carboxylic acid.
What is the SMILES notation for 3-(4-propan-2-ylcyclohexyl)-1,2-oxazole-4-carboxylic acid?
The canonical SMILES for 3-(4-propan-2-ylcyclohexyl)-1,2-oxazole-4-carboxylic acid is CC(C)C1CCC(c2nocc2C(=O)O)CC1.
What is the InChIKey of 3-(4-propan-2-ylcyclohexyl)-1,2-oxazole-4-carboxylic acid?
The InChIKey is XYGAHGKITXGMEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO3/c1-8(2)9-3-5-10(6-4-9)12-11(13(15)16)7-17-14-12/h7-10H,3-6H2,1-2H3,(H,15,16).
What are the key properties of 3-(4-propan-2-ylcyclohexyl)-1,2-oxazole-4-carboxylic acid?
3-(4-propan-2-ylcyclohexyl)-1,2-oxazole-4-carboxylic acid has a molecular weight of 237.30 g/mol, XLogP of 3.30, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-propan-2-ylcyclohexyl)-1,2-oxazole-4-carboxylic acid is sourced from PubChem (CID 125426240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).