C11H19N3 — CID 125426308
(1R,2R,4R)-1-(1H-imidazol-2-yl)-2,4-dimethylcyclohexan-1-amine (PubChem CID 125426308) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is (1R,2R,4R)-1-(1H-imidazol-2-yl)-2,4-dimethylcyclohexan-1-amine.
| Compound Name | (1R,2R,4R)-1-(1H-imidazol-2-yl)-2,4-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 125426308 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | (1R,2R,4R)-1-(1H-imidazol-2-yl)-2,4-dimethylcyclohexan-1-amine |
| SMILES | C[C@@H]1CC[C@](N)(c2ncc[nH]2)[C@H](C)C1 |
| InChI | InChI=1S/C11H19N3/c1-8-3-4-11(12,9(2)7-8)10-13-5-6-14-10/h5-6,8-9H,3-4,7,12H2,1-2H3,(H,13,14)/t8-,9-,11-/m1/s1 |
| InChIKey | HSJZOBAPYGXBQX-FXPVBKGRSA-N |
| XLogP | 2.02 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |