C10H13BrN2O2 — CID 125427211
4-bromo-1-ethyl-5-[(1S,4R,5S)-4-methyl-3,6-dioxabicyclo[3.1.0]hexan-1-yl]pyrazole (PubChem CID 125427211) has the molecular formula C10H13BrN2O2 and a molecular weight of 273.13 g/mol. Its IUPAC name is 4-bromo-1-ethyl-5-[(1S,4R,5S)-4-methyl-3,6-dioxabicyclo[3.1.0]hexan-1-yl]pyrazole.
| Compound Name | 4-bromo-1-ethyl-5-[(1S,4R,5S)-4-methyl-3,6-dioxabicyclo[3.1.0]hexan-1-yl]pyrazole |
|---|---|
| PubChem CID | 125427211 |
| Molecular Formula | C10H13BrN2O2 |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 4-bromo-1-ethyl-5-[(1S,4R,5S)-4-methyl-3,6-dioxabicyclo[3.1.0]hexan-1-yl]pyrazole |
| SMILES | CCn1ncc(Br)c1[C@]12CO[C@H](C)[C@@H]1O2 |
| InChI | InChI=1S/C10H13BrN2O2/c1-3-13-8(7(11)4-12-13)10-5-14-6(2)9(10)15-10/h4,6,9H,3,5H2,1-2H3/t6-,9+,10-/m1/s1 |
| InChIKey | UGUNLCPQRAUGNQ-WHFVKQHSSA-N |
| XLogP | 1.68 |
| TPSA | 39.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|