C26H28N4O6 — CID 125427985
(1R,9R,12S)-10-[2-(6,7-dimethoxy-2-methyl-4-oxoquinazolin-3-yl)ethyl]-9-methyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide (PubChem CID 125427985) has the molecular formula C26H28N4O6 and a molecular weight of 492.53 g/mol. Its IUPAC name is (1R,9R,12S)-10-[2-(6,7-dimethoxy-2-methyl-4-oxoquinazolin-3-yl)ethyl]-9-methyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide.
| Compound Name | (1R,9R,12S)-10-[2-(6,7-dimethoxy-2-methyl-4-oxoquinazolin-3-yl)ethyl]-9-methyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide |
|---|---|
| PubChem CID | 125427985 |
| Molecular Formula | C26H28N4O6 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | (1R,9R,12S)-10-[2-(6,7-dimethoxy-2-methyl-4-oxoquinazolin-3-yl)ethyl]-9-methyl-11-oxo-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide |
| SMILES | COc1cc2nc(C)n(CCN3C(=O)[C@H](C(N)=O)[C@H]4C[C@@]3(C)Oc3ccccc34)c(=O)c2cc1OC |
| InChI | InChI=1S/C26H28N4O6/c1-14-28-18-12-21(35-4)20(34-3)11-16(18)24(32)29(14)9-10-30-25(33)22(23(27)31)17-13-26(30,2)36-19-8-6-5-7-15(17)19/h5-8,11-12,17,22H,9-10,13H2,1-4H3,(H2,27,31)/t17-,22-,26+/m0/s1 |
| InChIKey | QPTQDKBBRWYXDR-VAQYAFAPSA-N |
| XLogP | 1.95 |
| TPSA | 125.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|