C30H31N2O4+ — CID 125428385
(1R,11S,12E,14S,17S)-14-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-oxoethyl]-12-ethylidene-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraene-10-carbaldehyde (PubChem CID 125428385) has the molecular formula C30H31N2O4+ and a molecular weight of 483.59 g/mol. Its IUPAC name is (1R,11S,12E,14S,17S)-14-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-oxoethyl]-12-ethylidene-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraene-10-carbaldehyde.
| Compound Name | (1R,11S,12E,14S,17S)-14-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-oxoethyl]-12-ethylidene-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraene-10-carbaldehyde |
|---|---|
| PubChem CID | 125428385 |
| Molecular Formula | C30H31N2O4+ |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | (1R,11S,12E,14S,17S)-14-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-oxoethyl]-12-ethylidene-8-aza-14-azoniapentacyclo[9.5.2.01,9.02,7.014,17]octadeca-2,4,6,9-tetraene-10-carbaldehyde |
| SMILES | C/C=C1/C[N@+]2(CC(=O)c3ccc4c(c3)OCCCO4)CC[C@]34C(=C(C=O)[C@H]1C[C@@H]32)Nc1ccccc14 |
| InChI | InChI=1S/C30H30N2O4/c1-2-19-16-32(17-25(34)20-8-9-26-27(14-20)36-13-5-12-35-26)11-10-30-23-6-3-4-7-24(23)31-29(30)22(18-33)21(19)15-28(30)32/h2-4,6-9,14,18,21,28H,5,10-13,15-17H2,1H3/p+1/b19-2-/t21-,28-,30+,32-/m0/s1 |
| InChIKey | JAGOZOHOYMUONR-SIYGTZFYSA-O |
| XLogP | 4.42 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|