C34H36N2O5 — CID 125429035
(1S,2R,9R)-11-[3-(2,5,9-trimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)propanoyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 125429035) has the molecular formula C34H36N2O5 and a molecular weight of 552.67 g/mol. Its IUPAC name is (1S,2R,9R)-11-[3-(2,5,9-trimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)propanoyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1S,2R,9R)-11-[3-(2,5,9-trimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)propanoyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 125429035 |
| Molecular Formula | C34H36N2O5 |
| Molecular Weight | 552.67 g/mol |
| Exact Mass | 552.26 |
| IUPAC Name | (1S,2R,9R)-11-[3-(2,5,9-trimethyl-7-oxo-3-phenylfuro[3,2-g]chromen-6-yl)propanoyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | Cc1oc2c(C)c3oc(=O)c(CCC(=O)N4C[C@H]5C[C@@H](C4)[C@H]4CCCC(=O)N4C5)c(C)c3cc2c1-c1ccccc1 |
| InChI | InChI=1S/C34H36N2O5/c1-19-25(12-13-29(37)35-16-22-14-24(18-35)28-10-7-11-30(38)36(28)17-22)34(39)41-32-20(2)33-27(15-26(19)32)31(21(3)40-33)23-8-5-4-6-9-23/h4-6,8-9,15,22,24,28H,7,10-14,16-18H2,1-3H3/t22-,24+,28-/m1/s1 |
| InChIKey | IRHPWDBTQSQSQD-ZXDNMGRFSA-N |
| XLogP | 5.92 |
| TPSA | 83.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.67 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|