C26H28N2O5 — CID 125429543
(1S,2R,9R)-11-[2-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 125429543) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is (1S,2R,9R)-11-[2-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1S,2R,9R)-11-[2-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 125429543 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | (1S,2R,9R)-11-[2-(3,5-dimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | Cc1coc2cc3oc(=O)c(CC(=O)N4C[C@H]5C[C@@H](C4)[C@H]4CCCC(=O)N4C5)c(C)c3cc12 |
| InChI | InChI=1S/C26H28N2O5/c1-14-13-32-22-9-23-19(7-18(14)22)15(2)20(26(31)33-23)8-25(30)27-10-16-6-17(12-27)21-4-3-5-24(29)28(21)11-16/h7,9,13,16-17,21H,3-6,8,10-12H2,1-2H3/t16-,17+,21-/m1/s1 |
| InChIKey | CRWBKSFEXIYZNQ-LLGFUMIMSA-N |
| XLogP | 3.56 |
| TPSA | 83.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|