C22H16N2O5 — CID 125429817
(10R)-5-hydroxy-10-(1-methylpyrazol-4-yl)-3-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione (PubChem CID 125429817) has the molecular formula C22H16N2O5 and a molecular weight of 388.38 g/mol. Its IUPAC name is (10R)-5-hydroxy-10-(1-methylpyrazol-4-yl)-3-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione.
| Compound Name | (10R)-5-hydroxy-10-(1-methylpyrazol-4-yl)-3-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
|---|---|
| PubChem CID | 125429817 |
| Molecular Formula | C22H16N2O5 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | (10R)-5-hydroxy-10-(1-methylpyrazol-4-yl)-3-phenyl-9,10-dihydropyrano[2,3-h]chromene-4,8-dione |
| SMILES | Cn1cc([C@H]2CC(=O)Oc3cc(O)c4c(=O)c(-c5ccccc5)coc4c32)cn1 |
| InChI | InChI=1S/C22H16N2O5/c1-24-10-13(9-23-24)14-7-18(26)29-17-8-16(25)20-21(27)15(11-28-22(20)19(14)17)12-5-3-2-4-6-12/h2-6,8-11,14,25H,7H2,1H3/t14-/m1/s1 |
| InChIKey | NQZJQTDYCKICOZ-CQSZACIVSA-N |
| XLogP | 3.34 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|