C21H26N4O4 — CID 125430361
(1R,9R,12R)-9-methyl-11-oxo-10-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide (PubChem CID 125430361) has the molecular formula C21H26N4O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is (1R,9R,12R)-9-methyl-11-oxo-10-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide.
| Compound Name | (1R,9R,12R)-9-methyl-11-oxo-10-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide |
|---|---|
| PubChem CID | 125430361 |
| Molecular Formula | C21H26N4O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | (1R,9R,12R)-9-methyl-11-oxo-10-[3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)propyl]-8-oxa-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene-12-carboxamide |
| SMILES | CC(C)c1noc(CCCN2C(=O)[C@@H](C(N)=O)[C@H]3C[C@@]2(C)Oc2ccccc23)n1 |
| InChI | InChI=1S/C21H26N4O4/c1-12(2)19-23-16(29-24-19)9-6-10-25-20(27)17(18(22)26)14-11-21(25,3)28-15-8-5-4-7-13(14)15/h4-5,7-8,12,14,17H,6,9-11H2,1-3H3,(H2,22,26)/t14-,17+,21+/m0/s1 |
| InChIKey | JLPTUTFSKOOYBO-AVBTWRTFSA-N |
| XLogP | 2.35 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|