About 2-(1,1-diphosphonoethyl)butanedioic acid
2-(1,1-diphosphonoethyl)butanedioic acid (PubChem CID 12543047) has the molecular formula C6H12O10P2
and a molecular weight of 306.10 g/mol. Its IUPAC name is 2-(1,1-diphosphonoethyl)butanedioic acid.
Molecular Properties
| Compound Name | 2-(1,1-diphosphonoethyl)butanedioic acid |
| PubChem CID | 12543047 |
| Molecular Formula | C6H12O10P2 |
| Molecular Weight | 306.10 g/mol |
| Exact Mass | 305.99 |
| IUPAC Name | 2-(1,1-diphosphonoethyl)butanedioic acid |
| SMILES | CC(C(CC(=O)O)C(=O)O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C6H12O10P2/c1-6(17(11,12)13,18(14,15)16)3(5(9)10)2-4(7)8/h3H,2H2,1H3,(H,7,8)(H,9,10)(H2,11,12,13)(H2,14,15,16) |
| InChIKey | GAPYCUKJBQZFAZ-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 189.66 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.10 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,1-diphosphonoethyl)butanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-diphosphonoethyl)butanedioic acid?
The IUPAC name of 2-(1,1-diphosphonoethyl)butanedioic acid (CID 12543047) is 2-(1,1-diphosphonoethyl)butanedioic acid.
What is the SMILES notation for 2-(1,1-diphosphonoethyl)butanedioic acid?
The canonical SMILES for 2-(1,1-diphosphonoethyl)butanedioic acid is CC(C(CC(=O)O)C(=O)O)(P(=O)(O)O)P(=O)(O)O.
What is the InChIKey of 2-(1,1-diphosphonoethyl)butanedioic acid?
The InChIKey is GAPYCUKJBQZFAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O10P2/c1-6(17(11,12)13,18(14,15)16)3(5(9)10)2-4(7)8/h3H,2H2,1H3,(H,7,8)(H,9,10)(H2,11,12,13)(H2,14,15,16).
What are the key properties of 2-(1,1-diphosphonoethyl)butanedioic acid?
2-(1,1-diphosphonoethyl)butanedioic acid has a molecular weight of 306.10 g/mol, XLogP of -0.77, 6 rotatable bonds, 6 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-diphosphonoethyl)butanedioic acid is sourced from PubChem (CID 12543047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).