C25H30N4O4 — CID 125430795
5,6-dimethoxy-1-methyl-N-[2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]indole-2-carboxamide (PubChem CID 125430795) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is 5,6-dimethoxy-1-methyl-N-[2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]indole-2-carboxamide.
| Compound Name | 5,6-dimethoxy-1-methyl-N-[2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 125430795 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 5,6-dimethoxy-1-methyl-N-[2-[(1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl]ethyl]indole-2-carboxamide |
| SMILES | COc1cc2cc(C(=O)NCCN3C[C@H]4C[C@@H](C3)c3cccc(=O)n3C4)n(C)c2cc1OC |
| InChI | InChI=1S/C25H30N4O4/c1-27-20-12-23(33-3)22(32-2)11-17(20)10-21(27)25(31)26-7-8-28-13-16-9-18(15-28)19-5-4-6-24(30)29(19)14-16/h4-6,10-12,16,18H,7-9,13-15H2,1-3H3,(H,26,31)/t16-,18+/m1/s1 |
| InChIKey | CWWQVOXRAXRVGC-AEFFLSMTSA-N |
| XLogP | 2.21 |
| TPSA | 77.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |