About 1,2,4-trimethylpyridin-1-ium iodide
1,2,4-trimethylpyridin-1-ium iodide (PubChem CID 12543163) has the molecular formula C8H12IN
and a molecular weight of 249.09 g/mol. Its IUPAC name is 1,2,4-trimethylpyridin-1-ium iodide.
Molecular Properties
| Compound Name | 1,2,4-trimethylpyridin-1-ium iodide |
| PubChem CID | 12543163 |
| Molecular Formula | C8H12IN |
| Molecular Weight | 249.09 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | 1,2,4-trimethylpyridin-1-ium iodide |
| SMILES | Cc1cc[n+](C)c(C)c1.[I-] |
| InChI | InChI=1S/C8H12N.HI/c1-7-4-5-9(3)8(2)6-7;/h4-6H,1-3H3;1H/q+1;/p-1 |
| InChIKey | QYDJCYFTRFULIB-UHFFFAOYSA-M |
| XLogP | -1.87 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.09 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1,2,4-trimethylpyridin-1-ium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,4-trimethylpyridin-1-ium iodide?
The IUPAC name of 1,2,4-trimethylpyridin-1-ium iodide (CID 12543163) is 1,2,4-trimethylpyridin-1-ium iodide.
What is the SMILES notation for 1,2,4-trimethylpyridin-1-ium iodide?
The canonical SMILES for 1,2,4-trimethylpyridin-1-ium iodide is Cc1cc[n+](C)c(C)c1.[I-].
What is the InChIKey of 1,2,4-trimethylpyridin-1-ium iodide?
The InChIKey is QYDJCYFTRFULIB-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H12N.HI/c1-7-4-5-9(3)8(2)6-7;/h4-6H,1-3H3;1H/q+1;/p-1.
What are the key properties of 1,2,4-trimethylpyridin-1-ium iodide?
1,2,4-trimethylpyridin-1-ium iodide has a molecular weight of 249.09 g/mol, XLogP of -1.87, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,4-trimethylpyridin-1-ium iodide is sourced from PubChem (CID 12543163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).