C18H15N3OS — CID 12543303
5-benzyl-11,13-dimethyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one (PubChem CID 12543303) has the molecular formula C18H15N3OS and a molecular weight of 321.40 g/mol. Its IUPAC name is 5-benzyl-11,13-dimethyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one.
| Compound Name | 5-benzyl-11,13-dimethyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
|---|---|
| PubChem CID | 12543303 |
| Molecular Formula | C18H15N3OS |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 5-benzyl-11,13-dimethyl-8-thia-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,10,12-pentaen-6-one |
| SMILES | Cc1cc(C)c2c(n1)sc1c(=O)n(Cc3ccccc3)cnc12 |
| InChI | InChI=1S/C18H15N3OS/c1-11-8-12(2)20-17-14(11)15-16(23-17)18(22)21(10-19-15)9-13-6-4-3-5-7-13/h3-8,10H,9H2,1-2H3 |
| InChIKey | ZENWQRUDVINYIS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |