About 3-[3-(2-methyl-1,3-thiazol-4-yl)anilino]-1,2-dihydropyrrol-5-one
3-[3-(2-methyl-1,3-thiazol-4-yl)anilino]-1,2-dihydropyrrol-5-one (PubChem CID 125433089) has the molecular formula C14H13N3OS
and a molecular weight of 271.35 g/mol. Its IUPAC name is 3-[3-(2-methyl-1,3-thiazol-4-yl)anilino]-1,2-dihydropyrrol-5-one.
Molecular Properties
| Compound Name | 3-[3-(2-methyl-1,3-thiazol-4-yl)anilino]-1,2-dihydropyrrol-5-one |
| PubChem CID | 125433089 |
| Molecular Formula | C14H13N3OS |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 3-[3-(2-methyl-1,3-thiazol-4-yl)anilino]-1,2-dihydropyrrol-5-one |
| SMILES | Cc1nc(-c2cccc(NC3=CC(=O)NC3)c2)cs1 |
| InChI | InChI=1S/C14H13N3OS/c1-9-16-13(8-19-9)10-3-2-4-11(5-10)17-12-6-14(18)15-7-12/h2-6,8,17H,7H2,1H3,(H,15,18) |
| InChIKey | OUZWBSYUGFZBCR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[3-(2-methyl-1,3-thiazol-4-yl)anilino]-1,2-dihydropyrrol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(2-methyl-1,3-thiazol-4-yl)anilino]-1,2-dihydropyrrol-5-one?
The IUPAC name of 3-[3-(2-methyl-1,3-thiazol-4-yl)anilino]-1,2-dihydropyrrol-5-one (CID 125433089) is 3-[3-(2-methyl-1,3-thiazol-4-yl)anilino]-1,2-dihydropyrrol-5-one.
What is the SMILES notation for 3-[3-(2-methyl-1,3-thiazol-4-yl)anilino]-1,2-dihydropyrrol-5-one?
The canonical SMILES for 3-[3-(2-methyl-1,3-thiazol-4-yl)anilino]-1,2-dihydropyrrol-5-one is Cc1nc(-c2cccc(NC3=CC(=O)NC3)c2)cs1.
What is the InChIKey of 3-[3-(2-methyl-1,3-thiazol-4-yl)anilino]-1,2-dihydropyrrol-5-one?
The InChIKey is OUZWBSYUGFZBCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3OS/c1-9-16-13(8-19-9)10-3-2-4-11(5-10)17-12-6-14(18)15-7-12/h2-6,8,17H,7H2,1H3,(H,15,18).
What are the key properties of 3-[3-(2-methyl-1,3-thiazol-4-yl)anilino]-1,2-dihydropyrrol-5-one?
3-[3-(2-methyl-1,3-thiazol-4-yl)anilino]-1,2-dihydropyrrol-5-one has a molecular weight of 271.35 g/mol, XLogP of 2.54, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(2-methyl-1,3-thiazol-4-yl)anilino]-1,2-dihydropyrrol-5-one is sourced from PubChem (CID 125433089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).