C20H21NO4 — CID 125433350
(4R)-6,7-dimethyl-4-[4-(2-methylprop-2-enoxy)phenyl]-3,4-dihydropyrano[3,2-c]pyridine-2,5-dione (PubChem CID 125433350) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is (4R)-6,7-dimethyl-4-[4-(2-methylprop-2-enoxy)phenyl]-3,4-dihydropyrano[3,2-c]pyridine-2,5-dione.
| Compound Name | (4R)-6,7-dimethyl-4-[4-(2-methylprop-2-enoxy)phenyl]-3,4-dihydropyrano[3,2-c]pyridine-2,5-dione |
|---|---|
| PubChem CID | 125433350 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | (4R)-6,7-dimethyl-4-[4-(2-methylprop-2-enoxy)phenyl]-3,4-dihydropyrano[3,2-c]pyridine-2,5-dione |
| SMILES | C=C(C)COc1ccc([C@H]2CC(=O)Oc3cc(C)n(C)c(=O)c32)cc1 |
| InChI | InChI=1S/C20H21NO4/c1-12(2)11-24-15-7-5-14(6-8-15)16-10-18(22)25-17-9-13(3)21(4)20(23)19(16)17/h5-9,16H,1,10-11H2,2-4H3/t16-/m1/s1 |
| InChIKey | PKZLQJMZIBDTFY-MRXNPFEDSA-N |
| XLogP | 3.09 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|