C18H38N2O — CID 125433376
N-[(2R,6S)-2,6-di(propan-2-yl)oxan-4-yl]-N',N'-diethylpropane-1,3-diamine (PubChem CID 125433376) has the molecular formula C18H38N2O and a molecular weight of 298.51 g/mol. Its IUPAC name is N-[(2R,6S)-2,6-di(propan-2-yl)oxan-4-yl]-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-[(2R,6S)-2,6-di(propan-2-yl)oxan-4-yl]-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 125433376 |
| Molecular Formula | C18H38N2O |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.30 |
| IUPAC Name | N-[(2R,6S)-2,6-di(propan-2-yl)oxan-4-yl]-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCNC1C[C@@H](C(C)C)O[C@@H](C(C)C)C1 |
| InChI | InChI=1S/C18H38N2O/c1-7-20(8-2)11-9-10-19-16-12-17(14(3)4)21-18(13-16)15(5)6/h14-19H,7-13H2,1-6H3/t16?,17-,18+ |
| InChIKey | BPDWPZDLLOSKQI-AYHJJNSGSA-N |
| XLogP | 3.54 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|