C24H25BrN2O6S2 — CID 125434402
5-(4-bromophenyl)sulfonyl-N-[[4-(dimethylamino)phenyl]methyl]-N-[(3R)-1,1-dioxothiolan-3-yl]furan-2-carboxamide (PubChem CID 125434402) has the molecular formula C24H25BrN2O6S2 and a molecular weight of 581.51 g/mol. Its IUPAC name is 5-(4-bromophenyl)sulfonyl-N-[[4-(dimethylamino)phenyl]methyl]-N-[(3R)-1,1-dioxothiolan-3-yl]furan-2-carboxamide.
| Compound Name | 5-(4-bromophenyl)sulfonyl-N-[[4-(dimethylamino)phenyl]methyl]-N-[(3R)-1,1-dioxothiolan-3-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 125434402 |
| Molecular Formula | C24H25BrN2O6S2 |
| Molecular Weight | 581.51 g/mol |
| Exact Mass | 580.03 |
| IUPAC Name | 5-(4-bromophenyl)sulfonyl-N-[[4-(dimethylamino)phenyl]methyl]-N-[(3R)-1,1-dioxothiolan-3-yl]furan-2-carboxamide |
| SMILES | CN(C)c1ccc(CN(C(=O)c2ccc(S(=O)(=O)c3ccc(Br)cc3)o2)[C@@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C24H25BrN2O6S2/c1-26(2)19-7-3-17(4-8-19)15-27(20-13-14-34(29,30)16-20)24(28)22-11-12-23(33-22)35(31,32)21-9-5-18(25)6-10-21/h3-12,20H,13-16H2,1-2H3/t20-/m1/s1 |
| InChIKey | ROSIUWIQFBQUAQ-HXUWFJFHSA-N |
| XLogP | 3.77 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|