About (1R,4R)-1-(3,5-difluorophenyl)sulfonylbicyclo[2.1.0]pentane
(1R,4R)-1-(3,5-difluorophenyl)sulfonylbicyclo[2.1.0]pentane (PubChem CID 125434703) has the molecular formula C11H10F2O2S
and a molecular weight of 244.26 g/mol. Its IUPAC name is (1R,4R)-1-(3,5-difluorophenyl)sulfonylbicyclo[2.1.0]pentane.
Molecular Properties
| Compound Name | (1R,4R)-1-(3,5-difluorophenyl)sulfonylbicyclo[2.1.0]pentane |
| PubChem CID | 125434703 |
| Molecular Formula | C11H10F2O2S |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | (1R,4R)-1-(3,5-difluorophenyl)sulfonylbicyclo[2.1.0]pentane |
| SMILES | O=S(=O)(c1cc(F)cc(F)c1)[C@@]12CC[C@@H]1C2 |
| InChI | InChI=1S/C11H10F2O2S/c12-8-3-9(13)5-10(4-8)16(14,15)11-2-1-7(11)6-11/h3-5,7H,1-2,6H2/t7-,11-/m1/s1 |
| InChIKey | IZBMPDKWKGIJQD-RDDDGLTNSA-N |
| XLogP | 2.29 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1R,4R)-1-(3,5-difluorophenyl)sulfonylbicyclo[2.1.0]pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,4R)-1-(3,5-difluorophenyl)sulfonylbicyclo[2.1.0]pentane?
The IUPAC name of (1R,4R)-1-(3,5-difluorophenyl)sulfonylbicyclo[2.1.0]pentane (CID 125434703) is (1R,4R)-1-(3,5-difluorophenyl)sulfonylbicyclo[2.1.0]pentane.
What is the SMILES notation for (1R,4R)-1-(3,5-difluorophenyl)sulfonylbicyclo[2.1.0]pentane?
The canonical SMILES for (1R,4R)-1-(3,5-difluorophenyl)sulfonylbicyclo[2.1.0]pentane is O=S(=O)(c1cc(F)cc(F)c1)[C@@]12CC[C@@H]1C2.
What is the InChIKey of (1R,4R)-1-(3,5-difluorophenyl)sulfonylbicyclo[2.1.0]pentane?
The InChIKey is IZBMPDKWKGIJQD-RDDDGLTNSA-N. The full InChI is InChI=1S/C11H10F2O2S/c12-8-3-9(13)5-10(4-8)16(14,15)11-2-1-7(11)6-11/h3-5,7H,1-2,6H2/t7-,11-/m1/s1.
What are the key properties of (1R,4R)-1-(3,5-difluorophenyl)sulfonylbicyclo[2.1.0]pentane?
(1R,4R)-1-(3,5-difluorophenyl)sulfonylbicyclo[2.1.0]pentane has a molecular weight of 244.26 g/mol, XLogP of 2.29, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,4R)-1-(3,5-difluorophenyl)sulfonylbicyclo[2.1.0]pentane is sourced from PubChem (CID 125434703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).