About CID 12543543
CID 12543543 (PubChem CID 12543543) has the molecular formula C4H5O2
and a molecular weight of 85.08 g/mol.
Molecular Properties
| Compound Name | CID 12543543 |
| PubChem CID | 12543543 |
| Molecular Formula | C4H5O2 |
| Molecular Weight | 85.08 g/mol |
| Exact Mass | 85.03 |
| IUPAC Name | — |
| SMILES | [CH]=CC(=O)OC |
| InChI | InChI=1S/C4H5O2/c1-3-4(5)6-2/h1,3H,2H3 |
| InChIKey | AYDHKVDAFIGYJU-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 85.08 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 12543543 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 12543543?
The IUPAC name of CID 12543543 (CID 12543543) is not available.
What is the SMILES notation for CID 12543543?
The canonical SMILES for CID 12543543 is [CH]=CC(=O)OC.
What is the InChIKey of CID 12543543?
The InChIKey is AYDHKVDAFIGYJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5O2/c1-3-4(5)6-2/h1,3H,2H3.
What are the key properties of CID 12543543?
CID 12543543 has a molecular weight of 85.08 g/mol, XLogP of 0.15, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 12543543 is sourced from PubChem (CID 12543543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).