About 1-methyl-1-[3-(1-methylimidazol-2-yl)propyl]-3-(4-methyl-3-oxo-1,4-benzoxazin-7-yl)urea
1-methyl-1-[3-(1-methylimidazol-2-yl)propyl]-3-(4-methyl-3-oxo-1,4-benzoxazin-7-yl)urea (PubChem CID 125436394) has the molecular formula C18H23N5O3
and a molecular weight of 357.41 g/mol. Its IUPAC name is 1-methyl-1-[3-(1-methylimidazol-2-yl)propyl]-3-(4-methyl-3-oxo-1,4-benzoxazin-7-yl)urea.
Molecular Properties
| Compound Name | 1-methyl-1-[3-(1-methylimidazol-2-yl)propyl]-3-(4-methyl-3-oxo-1,4-benzoxazin-7-yl)urea |
| PubChem CID | 125436394 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 1-methyl-1-[3-(1-methylimidazol-2-yl)propyl]-3-(4-methyl-3-oxo-1,4-benzoxazin-7-yl)urea |
| SMILES | CN(CCCc1nccn1C)C(=O)Nc1ccc2c(c1)OCC(=O)N2C |
| InChI | InChI=1S/C18H23N5O3/c1-21-10-8-19-16(21)5-4-9-22(2)18(25)20-13-6-7-14-15(11-13)26-12-17(24)23(14)3/h6-8,10-11H,4-5,9,12H2,1-3H3,(H,20,25) |
| InChIKey | KYAOIEZBWSXLII-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-methyl-1-[3-(1-methylimidazol-2-yl)propyl]-3-(4-methyl-3-oxo-1,4-benzoxazin-7-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-1-[3-(1-methylimidazol-2-yl)propyl]-3-(4-methyl-3-oxo-1,4-benzoxazin-7-yl)urea?
The IUPAC name of 1-methyl-1-[3-(1-methylimidazol-2-yl)propyl]-3-(4-methyl-3-oxo-1,4-benzoxazin-7-yl)urea (CID 125436394) is 1-methyl-1-[3-(1-methylimidazol-2-yl)propyl]-3-(4-methyl-3-oxo-1,4-benzoxazin-7-yl)urea.
What is the SMILES notation for 1-methyl-1-[3-(1-methylimidazol-2-yl)propyl]-3-(4-methyl-3-oxo-1,4-benzoxazin-7-yl)urea?
The canonical SMILES for 1-methyl-1-[3-(1-methylimidazol-2-yl)propyl]-3-(4-methyl-3-oxo-1,4-benzoxazin-7-yl)urea is CN(CCCc1nccn1C)C(=O)Nc1ccc2c(c1)OCC(=O)N2C.
What is the InChIKey of 1-methyl-1-[3-(1-methylimidazol-2-yl)propyl]-3-(4-methyl-3-oxo-1,4-benzoxazin-7-yl)urea?
The InChIKey is KYAOIEZBWSXLII-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N5O3/c1-21-10-8-19-16(21)5-4-9-22(2)18(25)20-13-6-7-14-15(11-13)26-12-17(24)23(14)3/h6-8,10-11H,4-5,9,12H2,1-3H3,(H,20,25).
What are the key properties of 1-methyl-1-[3-(1-methylimidazol-2-yl)propyl]-3-(4-methyl-3-oxo-1,4-benzoxazin-7-yl)urea?
1-methyl-1-[3-(1-methylimidazol-2-yl)propyl]-3-(4-methyl-3-oxo-1,4-benzoxazin-7-yl)urea has a molecular weight of 357.41 g/mol, XLogP of 1.87, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-1-[3-(1-methylimidazol-2-yl)propyl]-3-(4-methyl-3-oxo-1,4-benzoxazin-7-yl)urea is sourced from PubChem (CID 125436394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).