C18H22N4O — CID 125436777
(2S)-2-(benzimidazol-1-yl)-1-[(1S,2R,6S,7R)-4,10-diazatricyclo[5.2.1.02,6]decan-10-yl]propan-1-one (PubChem CID 125436777) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is (2S)-2-(benzimidazol-1-yl)-1-[(1S,2R,6S,7R)-4,10-diazatricyclo[5.2.1.02,6]decan-10-yl]propan-1-one.
| Compound Name | (2S)-2-(benzimidazol-1-yl)-1-[(1S,2R,6S,7R)-4,10-diazatricyclo[5.2.1.02,6]decan-10-yl]propan-1-one |
|---|---|
| PubChem CID | 125436777 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | (2S)-2-(benzimidazol-1-yl)-1-[(1S,2R,6S,7R)-4,10-diazatricyclo[5.2.1.02,6]decan-10-yl]propan-1-one |
| SMILES | C[C@@H](C(=O)N1[C@@H]2CC[C@H]1[C@H]1CNC[C@H]12)n1cnc2ccccc21 |
| InChI | InChI=1S/C18H22N4O/c1-11(21-10-20-14-4-2-3-5-17(14)21)18(23)22-15-6-7-16(22)13-9-19-8-12(13)15/h2-5,10-13,15-16,19H,6-9H2,1H3/t11-,12-,13+,15-,16+/m0/s1 |
| InChIKey | VSEVQLVMMJOORP-PLPKTUSISA-N |
| XLogP | 1.81 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |