C24H20N4O3S — CID 1254374
N-[[5-(1H-benzimidazol-2-yl)-2-methylphenyl]carbamothioyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 1254374) has the molecular formula C24H20N4O3S and a molecular weight of 444.52 g/mol. Its IUPAC name is N-[[5-(1H-benzimidazol-2-yl)-2-methylphenyl]carbamothioyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-[[5-(1H-benzimidazol-2-yl)-2-methylphenyl]carbamothioyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 1254374 |
| Molecular Formula | C24H20N4O3S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | N-[[5-(1H-benzimidazol-2-yl)-2-methylphenyl]carbamothioyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | Cc1ccc(-c2nc3ccccc3[nH]2)cc1NC(=S)NC(=O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C24H20N4O3S/c1-14-6-7-15(22-25-17-4-2-3-5-18(17)26-22)12-19(14)27-24(32)28-23(29)16-8-9-20-21(13-16)31-11-10-30-20/h2-9,12-13H,10-11H2,1H3,(H,25,26)(H2,27,28,29,32) |
| InChIKey | BVWHOZYQECWMFG-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|