C14H20N4O2 — CID 125438450
2-[[5-[[(2R)-2-propyl-2,5-dihydropyrrol-1-yl]methyl]pyrimidin-2-yl]amino]acetic acid (PubChem CID 125438450) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 2-[[5-[[(2R)-2-propyl-2,5-dihydropyrrol-1-yl]methyl]pyrimidin-2-yl]amino]acetic acid.
| Compound Name | 2-[[5-[[(2R)-2-propyl-2,5-dihydropyrrol-1-yl]methyl]pyrimidin-2-yl]amino]acetic acid |
|---|---|
| PubChem CID | 125438450 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 2-[[5-[[(2R)-2-propyl-2,5-dihydropyrrol-1-yl]methyl]pyrimidin-2-yl]amino]acetic acid |
| SMILES | CCC[C@@H]1C=CCN1Cc1cnc(NCC(=O)O)nc1 |
| InChI | InChI=1S/C14H20N4O2/c1-2-4-12-5-3-6-18(12)10-11-7-15-14(16-8-11)17-9-13(19)20/h3,5,7-8,12H,2,4,6,9-10H2,1H3,(H,19,20)(H,15,16,17)/t12-/m1/s1 |
| InChIKey | VQQYQHNFXNKFKK-GFCCVEGCSA-N |
| XLogP | 1.51 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|