C21H30N4O — CID 125438467
1-benzyl-1-(cyclobutylmethyl)-3-[(1S)-2-methyl-1-(1-methylimidazol-2-yl)propyl]urea (PubChem CID 125438467) has the molecular formula C21H30N4O and a molecular weight of 354.50 g/mol. Its IUPAC name is 1-benzyl-1-(cyclobutylmethyl)-3-[(1S)-2-methyl-1-(1-methylimidazol-2-yl)propyl]urea.
| Compound Name | 1-benzyl-1-(cyclobutylmethyl)-3-[(1S)-2-methyl-1-(1-methylimidazol-2-yl)propyl]urea |
|---|---|
| PubChem CID | 125438467 |
| Molecular Formula | C21H30N4O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | 1-benzyl-1-(cyclobutylmethyl)-3-[(1S)-2-methyl-1-(1-methylimidazol-2-yl)propyl]urea |
| SMILES | CC(C)[C@H](NC(=O)N(Cc1ccccc1)CC1CCC1)c1nccn1C |
| InChI | InChI=1S/C21H30N4O/c1-16(2)19(20-22-12-13-24(20)3)23-21(26)25(15-18-10-7-11-18)14-17-8-5-4-6-9-17/h4-6,8-9,12-13,16,18-19H,7,10-11,14-15H2,1-3H3,(H,23,26)/t19-/m0/s1 |
| InChIKey | RORCSXNQACLNKY-IBGZPJMESA-N |
| XLogP | 4.13 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |