C15H26N4O3 — CID 125439279
(2S)-N-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-2-(2-methoxyethyl)morpholine-4-carboxamide (PubChem CID 125439279) has the molecular formula C15H26N4O3 and a molecular weight of 310.40 g/mol. Its IUPAC name is (2S)-N-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-2-(2-methoxyethyl)morpholine-4-carboxamide.
| Compound Name | (2S)-N-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-2-(2-methoxyethyl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 125439279 |
| Molecular Formula | C15H26N4O3 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | (2S)-N-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-2-(2-methoxyethyl)morpholine-4-carboxamide |
| SMILES | CCn1ncc(CNC(=O)N2CCO[C@@H](CCOC)C2)c1C |
| InChI | InChI=1S/C15H26N4O3/c1-4-19-12(2)13(10-17-19)9-16-15(20)18-6-8-22-14(11-18)5-7-21-3/h10,14H,4-9,11H2,1-3H3,(H,16,20)/t14-/m0/s1 |
| InChIKey | DDIMRBQHSSWAPD-AWEZNQCLSA-N |
| XLogP | 1.16 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |