C12H22N4O2S — CID 125439977
N-[(1S)-2-methyl-1-(1-methylimidazol-2-yl)propyl]pyrrolidine-1-sulfonamide (PubChem CID 125439977) has the molecular formula C12H22N4O2S and a molecular weight of 286.40 g/mol. Its IUPAC name is N-[(1S)-2-methyl-1-(1-methylimidazol-2-yl)propyl]pyrrolidine-1-sulfonamide.
| Compound Name | N-[(1S)-2-methyl-1-(1-methylimidazol-2-yl)propyl]pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 125439977 |
| Molecular Formula | C12H22N4O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | N-[(1S)-2-methyl-1-(1-methylimidazol-2-yl)propyl]pyrrolidine-1-sulfonamide |
| SMILES | CC(C)[C@H](NS(=O)(=O)N1CCCC1)c1nccn1C |
| InChI | InChI=1S/C12H22N4O2S/c1-10(2)11(12-13-6-9-15(12)3)14-19(17,18)16-7-4-5-8-16/h6,9-11,14H,4-5,7-8H2,1-3H3/t11-/m0/s1 |
| InChIKey | ZWIDBTCFOYCQBF-NSHDSACASA-N |
| XLogP | 1.05 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |