About (1E,4E)-1,5-diphenylpenta-1,4-dien-3-ol
(1E,4E)-1,5-diphenylpenta-1,4-dien-3-ol (PubChem CID 12544085) has the molecular formula C17H16O
and a molecular weight of 236.31 g/mol. Its IUPAC name is (1E,4E)-1,5-diphenylpenta-1,4-dien-3-ol.
Molecular Properties
| Compound Name | (1E,4E)-1,5-diphenylpenta-1,4-dien-3-ol |
| PubChem CID | 12544085 |
| Molecular Formula | C17H16O |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | (1E,4E)-1,5-diphenylpenta-1,4-dien-3-ol |
| SMILES | OC(/C=C/c1ccccc1)/C=C/c1ccccc1 |
| InChI | InChI=1S/C17H16O/c18-17(13-11-15-7-3-1-4-8-15)14-12-16-9-5-2-6-10-16/h1-14,17-18H/b13-11+,14-12+ |
| InChIKey | HRTODTVBDNRDME-PHEQNACWSA-N |
| XLogP | 3.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1E,4E)-1,5-diphenylpenta-1,4-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E,4E)-1,5-diphenylpenta-1,4-dien-3-ol?
The IUPAC name of (1E,4E)-1,5-diphenylpenta-1,4-dien-3-ol (CID 12544085) is (1E,4E)-1,5-diphenylpenta-1,4-dien-3-ol.
What is the SMILES notation for (1E,4E)-1,5-diphenylpenta-1,4-dien-3-ol?
The canonical SMILES for (1E,4E)-1,5-diphenylpenta-1,4-dien-3-ol is OC(/C=C/c1ccccc1)/C=C/c1ccccc1.
What is the InChIKey of (1E,4E)-1,5-diphenylpenta-1,4-dien-3-ol?
The InChIKey is HRTODTVBDNRDME-PHEQNACWSA-N. The full InChI is InChI=1S/C17H16O/c18-17(13-11-15-7-3-1-4-8-15)14-12-16-9-5-2-6-10-16/h1-14,17-18H/b13-11+,14-12+.
What are the key properties of (1E,4E)-1,5-diphenylpenta-1,4-dien-3-ol?
(1E,4E)-1,5-diphenylpenta-1,4-dien-3-ol has a molecular weight of 236.31 g/mol, XLogP of 3.77, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1E,4E)-1,5-diphenylpenta-1,4-dien-3-ol is sourced from PubChem (CID 12544085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).