About 2-[4-(3,4-dichlorophenyl)-2-phenylimino-1,3-thiazol-3-yl]ethanol
2-[4-(3,4-dichlorophenyl)-2-phenylimino-1,3-thiazol-3-yl]ethanol (PubChem CID 1254428) has the molecular formula C17H14Cl2N2OS
and a molecular weight of 365.29 g/mol. Its IUPAC name is 2-[4-(3,4-dichlorophenyl)-2-phenylimino-1,3-thiazol-3-yl]ethanol.
Molecular Properties
| Compound Name | 2-[4-(3,4-dichlorophenyl)-2-phenylimino-1,3-thiazol-3-yl]ethanol |
| PubChem CID | 1254428 |
| Molecular Formula | C17H14Cl2N2OS |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | 2-[4-(3,4-dichlorophenyl)-2-phenylimino-1,3-thiazol-3-yl]ethanol |
| SMILES | OCCn1c(-c2ccc(Cl)c(Cl)c2)cs/c1=N\c1ccccc1 |
| InChI | InChI=1S/C17H14Cl2N2OS/c18-14-7-6-12(10-15(14)19)16-11-23-17(21(16)8-9-22)20-13-4-2-1-3-5-13/h1-7,10-11,22H,8-9H2/b20-17- |
| InChIKey | KPLSASQZMBENHL-JZJYNLBNSA-N |
| XLogP | 4.75 |
| TPSA | 37.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(3,4-dichlorophenyl)-2-phenylimino-1,3-thiazol-3-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(3,4-dichlorophenyl)-2-phenylimino-1,3-thiazol-3-yl]ethanol?
The IUPAC name of 2-[4-(3,4-dichlorophenyl)-2-phenylimino-1,3-thiazol-3-yl]ethanol (CID 1254428) is 2-[4-(3,4-dichlorophenyl)-2-phenylimino-1,3-thiazol-3-yl]ethanol.
What is the SMILES notation for 2-[4-(3,4-dichlorophenyl)-2-phenylimino-1,3-thiazol-3-yl]ethanol?
The canonical SMILES for 2-[4-(3,4-dichlorophenyl)-2-phenylimino-1,3-thiazol-3-yl]ethanol is OCCn1c(-c2ccc(Cl)c(Cl)c2)cs/c1=N\c1ccccc1.
What is the InChIKey of 2-[4-(3,4-dichlorophenyl)-2-phenylimino-1,3-thiazol-3-yl]ethanol?
The InChIKey is KPLSASQZMBENHL-JZJYNLBNSA-N. The full InChI is InChI=1S/C17H14Cl2N2OS/c18-14-7-6-12(10-15(14)19)16-11-23-17(21(16)8-9-22)20-13-4-2-1-3-5-13/h1-7,10-11,22H,8-9H2/b20-17-.
What are the key properties of 2-[4-(3,4-dichlorophenyl)-2-phenylimino-1,3-thiazol-3-yl]ethanol?
2-[4-(3,4-dichlorophenyl)-2-phenylimino-1,3-thiazol-3-yl]ethanol has a molecular weight of 365.29 g/mol, XLogP of 4.75, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3,4-dichlorophenyl)-2-phenylimino-1,3-thiazol-3-yl]ethanol is sourced from PubChem (CID 1254428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).