C14H23N3O2S — CID 125443435
N-[(1S)-3-methyl-1-pyridin-3-ylbutyl]pyrrolidine-1-sulfonamide (PubChem CID 125443435) has the molecular formula C14H23N3O2S and a molecular weight of 297.42 g/mol. Its IUPAC name is N-[(1S)-3-methyl-1-pyridin-3-ylbutyl]pyrrolidine-1-sulfonamide.
| Compound Name | N-[(1S)-3-methyl-1-pyridin-3-ylbutyl]pyrrolidine-1-sulfonamide |
|---|---|
| PubChem CID | 125443435 |
| Molecular Formula | C14H23N3O2S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-[(1S)-3-methyl-1-pyridin-3-ylbutyl]pyrrolidine-1-sulfonamide |
| SMILES | CC(C)C[C@H](NS(=O)(=O)N1CCCC1)c1cccnc1 |
| InChI | InChI=1S/C14H23N3O2S/c1-12(2)10-14(13-6-5-7-15-11-13)16-20(18,19)17-8-3-4-9-17/h5-7,11-12,14,16H,3-4,8-10H2,1-2H3/t14-/m0/s1 |
| InChIKey | QIABDXJQORRZDW-AWEZNQCLSA-N |
| XLogP | 2.10 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |